C19H21BrClFN6O3 — CID 135611178
4-bromo-2-chloro-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-morpholin-4-ylphenol (PubChem CID 135611178) has the molecular formula C19H21BrClFN6O3 and a molecular weight of 515.77 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-morpholin-4-ylphenol.
| Compound Name | 4-bromo-2-chloro-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-morpholin-4-ylphenol |
|---|---|
| PubChem CID | 135611178 |
| Molecular Formula | C19H21BrClFN6O3 |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 4-bromo-2-chloro-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-morpholin-4-ylphenol |
| SMILES | Oc1c(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)cc(Br)c(N2CCOCC2)c1Cl |
| InChI | InChI=1S/C19H21BrClFN6O3/c20-13-9-12(17(29)15(21)16(13)27-1-5-30-6-2-27)10-24-26-19-23-11-14(22)18(25-19)28-3-7-31-8-4-28/h9-11,29H,1-8H2,(H,23,25,26)/b24-10- |
| InChIKey | XTAUQSUCOCAZEN-VROXFSQNSA-N |
| XLogP | 2.86 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|