C22H20BrCl2FN6O2 — CID 91516506
4-bromo-2-chloro-3-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol (PubChem CID 91516506) has the molecular formula C22H20BrCl2FN6O2 and a molecular weight of 570.25 g/mol. Its IUPAC name is 4-bromo-2-chloro-3-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol.
| Compound Name | 4-bromo-2-chloro-3-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91516506 |
| Molecular Formula | C22H20BrCl2FN6O2 |
| Molecular Weight | 570.25 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | 4-bromo-2-chloro-3-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
| SMILES | Cc1cccc(Cl)c1Nc1c(Br)cc(C/N=N/c2ncc(F)c(N3CCOCC3)n2)c(O)c1Cl |
| InChI | InChI=1S/C22H20BrCl2FN6O2/c1-12-3-2-4-15(24)18(12)29-19-14(23)9-13(20(33)17(19)25)10-28-31-22-27-11-16(26)21(30-22)32-5-7-34-8-6-32/h2-4,9,11,29,33H,5-8,10H2,1H3/b31-28+ |
| InChIKey | VWNVJYRDXNDEJN-CCFHIKDMSA-N |
| XLogP | 6.56 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.25 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|