C22H21Cl2FN6O2 — CID 91111915
2-chloro-4-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol (PubChem CID 91111915) has the molecular formula C22H21Cl2FN6O2 and a molecular weight of 491.35 g/mol. Its IUPAC name is 2-chloro-4-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol.
| Compound Name | 2-chloro-4-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91111915 |
| Molecular Formula | C22H21Cl2FN6O2 |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-chloro-4-(2-chloro-6-methylanilino)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
| SMILES | Cc1cccc(Cl)c1Nc1cc(Cl)c(O)c(C/N=N/c2ncc(F)c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H21Cl2FN6O2/c1-13-3-2-4-16(23)19(13)28-15-9-14(20(32)17(24)10-15)11-27-30-22-26-12-18(25)21(29-22)31-5-7-33-8-6-31/h2-4,9-10,12,28,32H,5-8,11H2,1H3/b30-27+ |
| InChIKey | YBSDARDRYCGPOP-KDJFERLWSA-N |
| XLogP | 5.80 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|