C22H18BrClF4N6O2 — CID 91586484
4-bromo-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol (PubChem CID 91586484) has the molecular formula C22H18BrClF4N6O2 and a molecular weight of 589.78 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol.
| Compound Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol |
|---|---|
| PubChem CID | 91586484 |
| Molecular Formula | C22H18BrClF4N6O2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol |
| SMILES | Oc1c(C/N=N/c2ncc(F)c(N3CCOCC3)n2)cc(Br)c(Nc2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C22H18BrClF4N6O2/c23-15-8-12(10-30-33-21-29-11-16(25)20(32-21)34-4-6-36-7-5-34)19(35)17(24)18(15)31-14-3-1-2-13(9-14)22(26,27)28/h1-3,8-9,11,31,35H,4-7,10H2/b33-30+ |
| InChIKey | RMFBJXVESOMRDN-KKYHWDRJSA-N |
| XLogP | 6.62 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|