C28H31ClF4N8O2 — CID 91421336
2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenol (PubChem CID 91421336) has the molecular formula C28H31ClF4N8O2 and a molecular weight of 623.06 g/mol. Its IUPAC name is 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenol.
| Compound Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenol |
|---|---|
| PubChem CID | 91421336 |
| Molecular Formula | C28H31ClF4N8O2 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]phenol |
| SMILES | CN1CCN(Cc2ccc(Nc3ccc(C/N=N/c4ncc(F)c(N5CCOCC5)n4)c(O)c3Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H31ClF4N8O2/c1-39-6-8-40(9-7-39)17-19-2-4-20(14-21(19)28(31,32)33)36-23-5-3-18(25(42)24(23)29)15-35-38-27-34-16-22(30)26(37-27)41-10-12-43-13-11-41/h2-5,14,16,36,42H,6-13,15,17H2,1H3/b38-35+ |
| InChIKey | XHTCNDVXNHCFNS-OBEQGSJMSA-N |
| XLogP | 5.61 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|