C24H26Cl2FN7O2 — CID 90936661
2-chloro-4-(2-chloro-6-methylanilino)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol (PubChem CID 90936661) has the molecular formula C24H26Cl2FN7O2 and a molecular weight of 534.42 g/mol. Its IUPAC name is 2-chloro-4-(2-chloro-6-methylanilino)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol.
| Compound Name | 2-chloro-4-(2-chloro-6-methylanilino)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 90936661 |
| Molecular Formula | C24H26Cl2FN7O2 |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-chloro-4-(2-chloro-6-methylanilino)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol |
| SMILES | Cc1cccc(Cl)c1Nc1cc(Cl)c(O)c(C/N=N/c2ncc(F)c(N3CCN(CCO)CC3)n2)c1 |
| InChI | InChI=1S/C24H26Cl2FN7O2/c1-15-3-2-4-18(25)21(15)30-17-11-16(22(36)19(26)12-17)13-29-32-24-28-14-20(27)23(31-24)34-7-5-33(6-8-34)9-10-35/h2-4,11-12,14,30,35-36H,5-10,13H2,1H3/b32-29+ |
| InChIKey | XQHVFMHRWLOIHX-UUDCSCGESA-N |
| XLogP | 5.08 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|