C22H38BNO2Si — CID 91495673
CID 91495673 (PubChem CID 91495673) has the molecular formula C22H38BNO2Si and a molecular weight of 387.45 g/mol.
| Compound Name | CID 91495673 |
|---|---|
| PubChem CID | 91495673 |
| Molecular Formula | C22H38BNO2Si |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | — |
| SMILES | CC.[B]C(=O)N1C(CO[Si](C)(C)C(C)(C)C)C2C3C=CC(C3)C23CCCC13 |
| InChI | InChI=1S/C20H32BNO2Si.C2H6/c1-19(2,3)25(4,5)24-12-15-17-13-8-9-14(11-13)20(17)10-6-7-16(20)22(15)18(21)23;1-2/h8-9,13-17H,6-7,10-12H2,1-5H3;1-2H3 |
| InChIKey | HCRJQYNNEWYLID-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|