C18H29NO2Si — CID 73075140
tert-butyl-dimethyl-(9-oxa-8-azatetracyclo[9.2.1.02,7.02,10]tetradeca-7,12-dien-6-yloxy)silane (PubChem CID 73075140) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-(9-oxa-8-azatetracyclo[9.2.1.02,7.02,10]tetradeca-7,12-dien-6-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(9-oxa-8-azatetracyclo[9.2.1.02,7.02,10]tetradeca-7,12-dien-6-yloxy)silane |
|---|---|
| PubChem CID | 73075140 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl-dimethyl-(9-oxa-8-azatetracyclo[9.2.1.02,7.02,10]tetradeca-7,12-dien-6-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC23C1=NOC2C1C=CC3C1 |
| InChI | InChI=1S/C18H29NO2Si/c1-17(2,3)22(4,5)21-14-7-6-10-18-13-9-8-12(11-13)16(18)20-19-15(14)18/h8-9,12-14,16H,6-7,10-11H2,1-5H3 |
| InChIKey | VSYRUQXDZYBLTI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|