C12H10F4N2O3 — CID 91496231
3,4-bis(difluoromethoxy)-N-(1,3-oxazol-5-ylmethyl)aniline (PubChem CID 91496231) has the molecular formula C12H10F4N2O3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 3,4-bis(difluoromethoxy)-N-(1,3-oxazol-5-ylmethyl)aniline.
| Compound Name | 3,4-bis(difluoromethoxy)-N-(1,3-oxazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 91496231 |
| Molecular Formula | C12H10F4N2O3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3,4-bis(difluoromethoxy)-N-(1,3-oxazol-5-ylmethyl)aniline |
| SMILES | FC(F)Oc1ccc(NCc2cnco2)cc1OC(F)F |
| InChI | InChI=1S/C12H10F4N2O3/c13-11(14)20-9-2-1-7(3-10(9)21-12(15)16)18-5-8-4-17-6-19-8/h1-4,6,11-12,18H,5H2 |
| InChIKey | YKSDNNXXMODBQM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|