C27H37FN2O2 — CID 91504187
N-[2-[1-[6-(2-fluorophenyl)-6-hydroxyhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 91504187) has the molecular formula C27H37FN2O2 and a molecular weight of 440.60 g/mol. Its IUPAC name is N-[2-[1-[6-(2-fluorophenyl)-6-hydroxyhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-[1-[6-(2-fluorophenyl)-6-hydroxyhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 91504187 |
| Molecular Formula | C27H37FN2O2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-[2-[1-[6-(2-fluorophenyl)-6-hydroxyhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccccc1C1CCN(CCCCCC(O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H37FN2O2/c1-20(2)27(32)29-25-13-8-6-10-22(25)21-15-18-30(19-16-21)17-9-3-4-14-26(31)23-11-5-7-12-24(23)28/h5-8,10-13,20-21,26,31H,3-4,9,14-19H2,1-2H3,(H,29,32) |
| InChIKey | DXUIDNVWLRSVCA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|