C33H37F3N2O2 — CID 142926176
N-[5-[1-[6,6-bis(4-fluorophenyl)-5-oxohexyl]piperidin-4-yl]-2-fluorophenyl]-2-methylpropanamide (PubChem CID 142926176) has the molecular formula C33H37F3N2O2 and a molecular weight of 550.67 g/mol. Its IUPAC name is N-[5-[1-[6,6-bis(4-fluorophenyl)-5-oxohexyl]piperidin-4-yl]-2-fluorophenyl]-2-methylpropanamide.
| Compound Name | N-[5-[1-[6,6-bis(4-fluorophenyl)-5-oxohexyl]piperidin-4-yl]-2-fluorophenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142926176 |
| Molecular Formula | C33H37F3N2O2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | N-[5-[1-[6,6-bis(4-fluorophenyl)-5-oxohexyl]piperidin-4-yl]-2-fluorophenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cc(C2CCN(CCCCC(=O)C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C33H37F3N2O2/c1-22(2)33(40)37-30-21-26(10-15-29(30)36)23-16-19-38(20-17-23)18-4-3-5-31(39)32(24-6-11-27(34)12-7-24)25-8-13-28(35)14-9-25/h6-15,21-23,32H,3-5,16-20H2,1-2H3,(H,37,40) |
| InChIKey | PYOULXZZOUFZLJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|