C24H24ClNO3S — CID 91505265
4-(4-chlorophenyl)-2-(3,4,5-trimethoxyphenyl)-2,6,7,8-tetrahydro-1,5-benzothiazepine (PubChem CID 91505265) has the molecular formula C24H24ClNO3S and a molecular weight of 441.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(3,4,5-trimethoxyphenyl)-2,6,7,8-tetrahydro-1,5-benzothiazepine.
| Compound Name | 4-(4-chlorophenyl)-2-(3,4,5-trimethoxyphenyl)-2,6,7,8-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 91505265 |
| Molecular Formula | C24H24ClNO3S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(3,4,5-trimethoxyphenyl)-2,6,7,8-tetrahydro-1,5-benzothiazepine |
| SMILES | COc1cc(C2C=C(c3ccc(Cl)cc3)N=C3CCCC=C3S2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24ClNO3S/c1-27-20-12-16(13-21(28-2)24(20)29-3)23-14-19(15-8-10-17(25)11-9-15)26-18-6-4-5-7-22(18)30-23/h7-14,23H,4-6H2,1-3H3 |
| InChIKey | FHYYWEFYNJAXSB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |