C12H13FN6O2 — CID 9150717
N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(tetrazol-1-yl)acetamide (PubChem CID 9150717) has the molecular formula C12H13FN6O2 and a molecular weight of 292.27 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9150717 |
| Molecular Formula | C12H13FN6O2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(tetrazol-1-yl)acetamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)Cn1cnnn1 |
| InChI | InChI=1S/C12H13FN6O2/c1-18(12(21)7-19-8-14-16-17-19)6-11(20)15-10-4-2-3-9(13)5-10/h2-5,8H,6-7H2,1H3,(H,15,20) |
| InChIKey | FWWDLOBUJUZGTC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |