About azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol
azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol (PubChem CID 91509159) has the molecular formula C7H12N3O2P3
and a molecular weight of 263.11 g/mol. Its IUPAC name is azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol.
Molecular Properties
| Compound Name | azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol |
| PubChem CID | 91509159 |
| Molecular Formula | C7H12N3O2P3 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)ccc1O.[N-]=[N+]=NP(P)P |
| InChI | InChI=1S/C7H8O2.H4N3P3/c1-5-4-6(8)2-3-7(5)9;1-2-3-6(4)5/h2-4,8-9H,1H3;4-5H2 |
| InChIKey | JTBZRVLUAOYMIB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol?
The IUPAC name of azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol (CID 91509159) is azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol.
What is the SMILES notation for azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol?
The canonical SMILES for azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol is Cc1cc(O)ccc1O.[N-]=[N+]=NP(P)P.
What is the InChIKey of azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol?
The InChIKey is JTBZRVLUAOYMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.H4N3P3/c1-5-4-6(8)2-3-7(5)9;1-2-3-6(4)5/h2-4,8-9H,1H3;4-5H2.
What are the key properties of azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol?
azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol has a molecular weight of 263.11 g/mol, XLogP of 3.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azido-bis(phosphanyl)phosphane;2-methylbenzene-1,4-diol is sourced from PubChem (CID 91509159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).