C28H35NO4 — CID 91511086
(1S,9R,10R)-17-ethyl-6-hydroxy-4-(1-methoxy-1-phenylpropan-2-yl)oxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 91511086) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is (1S,9R,10R)-17-ethyl-6-hydroxy-4-(1-methoxy-1-phenylpropan-2-yl)oxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1S,9R,10R)-17-ethyl-6-hydroxy-4-(1-methoxy-1-phenylpropan-2-yl)oxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 91511086 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (1S,9R,10R)-17-ethyl-6-hydroxy-4-(1-methoxy-1-phenylpropan-2-yl)oxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CCN1CC[C@]23CC(=O)CC[C@H]2[C@H]1Cc1c(O)cc(OC(C)C(OC)c2ccccc2)cc13 |
| InChI | InChI=1S/C28H35NO4/c1-4-29-13-12-28-17-20(30)10-11-23(28)25(29)16-22-24(28)14-21(15-26(22)31)33-18(2)27(32-3)19-8-6-5-7-9-19/h5-9,14-15,18,23,25,27,31H,4,10-13,16-17H2,1-3H3/t18?,23-,25+,27?,28-/m0/s1 |
| InChIKey | LKECOELAMQYRBV-XLFREECOSA-N |
| XLogP | 4.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |