C29H35NO4 — CID 91323458
(4R,4aR,12bS)-9-(1-methoxy-1-phenylpropan-2-yl)oxy-3-propyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 91323458) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is (4R,4aR,12bS)-9-(1-methoxy-1-phenylpropan-2-yl)oxy-3-propyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,12bS)-9-(1-methoxy-1-phenylpropan-2-yl)oxy-3-propyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 91323458 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (4R,4aR,12bS)-9-(1-methoxy-1-phenylpropan-2-yl)oxy-3-propyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CCCN1CC[C@]23c4c5ccc(OC(C)C(OC)c6ccccc6)c4OC2C(=O)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C29H35NO4/c1-4-15-30-16-14-29-21-11-12-23(31)28(29)34-27-24(13-10-20(25(27)29)17-22(21)30)33-18(2)26(32-3)19-8-6-5-7-9-19/h5-10,13,18,21-22,26,28H,4,11-12,14-17H2,1-3H3/t18?,21-,22+,26?,28?,29-/m0/s1 |
| InChIKey | DPFNCIVUHDHHAD-CAGVOHQWSA-N |
| XLogP | 4.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |