C32H47N5O8S — CID 91511265
3-(2,5-dihydroxypyrrol-1-yl)-5-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]benzamide (PubChem CID 91511265) has the molecular formula C32H47N5O8S and a molecular weight of 661.82 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-5-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]benzamide.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-5-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]benzamide |
|---|---|
| PubChem CID | 91511265 |
| Molecular Formula | C32H47N5O8S |
| Molecular Weight | 661.82 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-5-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]benzamide |
| SMILES | Cc1cc(C(=O)NCCCOCCOCCOCCCNC(=O)CCCCC2SCC3NC(=O)NC32)cc(-n2c(O)ccc2O)c1 |
| InChI | InChI=1S/C32H47N5O8S/c1-22-18-23(20-24(19-22)37-28(39)8-9-29(37)40)31(41)34-11-5-13-44-15-17-45-16-14-43-12-4-10-33-27(38)7-3-2-6-26-30-25(21-46-26)35-32(42)36-30/h8-9,18-20,25-26,30,39-40H,2-7,10-17,21H2,1H3,(H,33,38)(H,34,41)(H2,35,36,42) |
| InChIKey | NEMHSXQAMZOUSK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 172.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|