C26H22ClN5O — CID 91512074
6-chloro-3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91512074) has the molecular formula C26H22ClN5O and a molecular weight of 455.95 g/mol. Its IUPAC name is 6-chloro-3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91512074 |
| Molecular Formula | C26H22ClN5O |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 6-chloro-3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CCNCc1ccc(/N=C(\c2ccc3nccnc3c2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C26H22ClN5O/c1-2-28-15-16-3-7-19(8-4-16)31-25(17-5-10-21-23(13-17)30-12-11-29-21)24-20-9-6-18(27)14-22(20)32-26(24)33/h3-14,24,28H,2,15H2,1H3,(H,32,33)/b31-25+ |
| InChIKey | FEOZQWKEXFEAKM-QCKNELIISA-N |
| XLogP | 5.25 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|