C25H21ClN4O3 — CID 91175087
5-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-(ethylaminomethyl)phenyl]carbonimidoyl]-3H-1,3-benzoxazol-2-one (PubChem CID 91175087) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is 5-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-(ethylaminomethyl)phenyl]carbonimidoyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-(ethylaminomethyl)phenyl]carbonimidoyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 91175087 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 5-[C-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)-N-[4-(ethylaminomethyl)phenyl]carbonimidoyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCNCc1ccc(/N=C(\c2ccc3oc(=O)[nH]c3c2)C2C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H21ClN4O3/c1-2-27-13-14-3-7-17(8-4-14)28-23(15-5-10-21-20(11-15)30-25(32)33-21)22-18-9-6-16(26)12-19(18)29-24(22)31/h3-12,22,27H,2,13H2,1H3,(H,29,31)(H,30,32)/b28-23+ |
| InChIKey | IQKZNFNLRYFWKI-WEMUOSSPSA-N |
| XLogP | 4.74 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|