C28H25N5O3 — CID 91551812
methyl 3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 91551812) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is methyl 3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 91551812 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | methyl 3-[N-[4-(ethylaminomethyl)phenyl]-C-quinoxalin-6-ylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | CCNCc1ccc(/N=C(\c2ccc3nccnc3c2)C2C(=O)Nc3cc(C(=O)OC)ccc32)cc1 |
| InChI | InChI=1S/C28H25N5O3/c1-3-29-16-17-4-8-20(9-5-17)32-26(18-7-11-22-24(14-18)31-13-12-30-22)25-21-10-6-19(28(35)36-2)15-23(21)33-27(25)34/h4-15,25,29H,3,16H2,1-2H3,(H,33,34)/b32-26+ |
| InChIKey | VIHOWEKSYYZMLK-HMZBKAONSA-N |
| XLogP | 4.38 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|