C36H38O2 — CID 91512764
4b,9b-bis(2,3,4,5,6-pentamethylphenyl)-[1]benzofuro[3,2-b][1]benzofuran (PubChem CID 91512764) has the molecular formula C36H38O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 4b,9b-bis(2,3,4,5,6-pentamethylphenyl)-[1]benzofuro[3,2-b][1]benzofuran.
| Compound Name | 4b,9b-bis(2,3,4,5,6-pentamethylphenyl)-[1]benzofuro[3,2-b][1]benzofuran |
|---|---|
| PubChem CID | 91512764 |
| Molecular Formula | C36H38O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 4b,9b-bis(2,3,4,5,6-pentamethylphenyl)-[1]benzofuro[3,2-b][1]benzofuran |
| SMILES | Cc1c(C)c(C)c(C23Oc4ccccc4C2(c2c(C)c(C)c(C)c(C)c2C)Oc2ccccc23)c(C)c1C |
| InChI | InChI=1S/C36H38O2/c1-19-21(3)25(7)33(26(8)22(19)4)35-29-15-11-13-17-31(29)38-36(35,30-16-12-14-18-32(30)37-35)34-27(9)23(5)20(2)24(6)28(34)10/h11-18H,1-10H3 |
| InChIKey | QDEGNORUCBKPFY-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |