C20H37NO — CID 54278452
ethane;2,2,3,3,4,5,5-heptamethyl-1,4-benzoxazepine (PubChem CID 54278452) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is ethane;2,2,3,3,4,5,5-heptamethyl-1,4-benzoxazepine.
| Compound Name | ethane;2,2,3,3,4,5,5-heptamethyl-1,4-benzoxazepine |
|---|---|
| PubChem CID | 54278452 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | ethane;2,2,3,3,4,5,5-heptamethyl-1,4-benzoxazepine |
| SMILES | CC.CC.CN1C(C)(C)c2ccccc2OC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H25NO.2C2H6/c1-14(2)12-10-8-9-11-13(12)18-16(5,6)15(3,4)17(14)7;2*1-2/h8-11H,1-7H3;2*1-2H3 |
| InChIKey | RPBUPKRJLBNQRI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |