C12H11ClN2O — CID 91514814
5-[(4-chlorophenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one (PubChem CID 91514814) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 91514814 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
| SMILES | C=c1[nH]c(=Cc2ccc(Cl)cc2)c(=O)n1C |
| InChI | InChI=1S/C12H11ClN2O/c1-8-14-11(12(16)15(8)2)7-9-3-5-10(13)6-4-9/h3-7,14H,1H2,2H3 |
| InChIKey | DNAGNJDHQBVGJI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |