C16H20BF2N3O — CID 123523108
(5Z)-5-[[4-(diethylamino)-2-difluoroboranylphenyl]methylidene]-3-methyl-2-methylideneimidazolidin-4-one (PubChem CID 123523108) has the molecular formula C16H20BF2N3O and a molecular weight of 319.16 g/mol. Its IUPAC name is (5Z)-5-[[4-(diethylamino)-2-difluoroboranylphenyl]methylidene]-3-methyl-2-methylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(diethylamino)-2-difluoroboranylphenyl]methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 123523108 |
| Molecular Formula | C16H20BF2N3O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (5Z)-5-[[4-(diethylamino)-2-difluoroboranylphenyl]methylidene]-3-methyl-2-methylideneimidazolidin-4-one |
| SMILES | C=c1[nH]/c(=C\c2ccc(N(CC)CC)cc2B(F)F)c(=O)n1C |
| InChI | InChI=1S/C16H20BF2N3O/c1-5-22(6-2)13-8-7-12(14(10-13)17(18)19)9-15-16(23)21(4)11(3)20-15/h7-10,20H,3,5-6H2,1-2,4H3/b15-9- |
| InChIKey | HPTLFRXASJBIQT-DHDCSXOGSA-N |
| XLogP | 0.43 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|