C20H28N4O — CID 91516842
N-(4-piperidin-1-ylphenyl)-1,2,4a,5,6,7,8,8a-octahydro-1,7-naphthyridine-3-carboxamide (PubChem CID 91516842) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-1,2,4a,5,6,7,8,8a-octahydro-1,7-naphthyridine-3-carboxamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-1,2,4a,5,6,7,8,8a-octahydro-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 91516842 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-1,2,4a,5,6,7,8,8a-octahydro-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C1=CC2CCNCC2NC1 |
| InChI | InChI=1S/C20H28N4O/c25-20(16-12-15-8-9-21-14-19(15)22-13-16)23-17-4-6-18(7-5-17)24-10-2-1-3-11-24/h4-7,12,15,19,21-22H,1-3,8-11,13-14H2,(H,23,25) |
| InChIKey | JIEXDHKFGYQWHD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|