C23H46O4Si — CID 91524996
[tert-butyl(dimethyl)silyl] (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate (PubChem CID 91524996) has the molecular formula C23H46O4Si and a molecular weight of 414.70 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate |
|---|---|
| PubChem CID | 91524996 |
| Molecular Formula | C23H46O4Si |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate |
| SMILES | COCOCCCC(C=CC(C)C)[C@@H](CC(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si/c1-18(2)13-14-20(12-11-15-26-17-25-8)21(16-19(3)4)22(24)27-28(9,10)23(5,6)7/h13-14,18-21H,11-12,15-17H2,1-10H3/t20?,21-/m1/s1 |
| InChIKey | JPPFKOBSEMMVLX-BPGUCPLFSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|