C17H32O4 — CID 91413966
(2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoic acid (PubChem CID 91413966) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoic acid.
| Compound Name | (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoic acid |
|---|---|
| PubChem CID | 91413966 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoic acid |
| SMILES | COCOCCC[C@H](C=CC(C)C)C(CC(C)C)C(=O)O |
| InChI | InChI=1S/C17H32O4/c1-13(2)8-9-15(7-6-10-21-12-20-5)16(17(18)19)11-14(3)4/h8-9,13-16H,6-7,10-12H2,1-5H3,(H,18,19)/t15-,16?/m1/s1 |
| InChIKey | XDYRFSPIPPCIRR-AAFJCEBUSA-N |
| XLogP | 3.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|