C18H17Cl2N3O4 — CID 9152510
ethyl N-[4-[[2-(2,5-dichloroanilino)-2-oxoethyl]carbamoyl]phenyl]carbamate (PubChem CID 9152510) has the molecular formula C18H17Cl2N3O4 and a molecular weight of 410.26 g/mol. Its IUPAC name is ethyl N-[4-[[2-(2,5-dichloroanilino)-2-oxoethyl]carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[2-(2,5-dichloroanilino)-2-oxoethyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9152510 |
| Molecular Formula | C18H17Cl2N3O4 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | ethyl N-[4-[[2-(2,5-dichloroanilino)-2-oxoethyl]carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C(=O)NCC(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O4/c1-2-27-18(26)22-13-6-3-11(4-7-13)17(25)21-10-16(24)23-15-9-12(19)5-8-14(15)20/h3-9H,2,10H2,1H3,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | LJSFHVXUUPFJBP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |