C13H22O2S — CID 91525593
1,2-dimethylcyclopentene;3,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 91525593) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is 1,2-dimethylcyclopentene;3,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | 1,2-dimethylcyclopentene;3,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 91525593 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,2-dimethylcyclopentene;3,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CC1=C(C)CCC1.CC1=C(C)CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12.C6H10O2S/c1-6-4-3-5-7(6)2;1-5-3-9(7,8)4-6(5)2/h3-5H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | SQBKIVGNONAZRO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|