C10H16S — CID 91526359
2,3,3a,7a-tetrahydro-1-benzothiophene;ethane (PubChem CID 91526359) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1-benzothiophene;ethane.
| Compound Name | 2,3,3a,7a-tetrahydro-1-benzothiophene;ethane |
|---|---|
| PubChem CID | 91526359 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1-benzothiophene;ethane |
| SMILES | C1=CC2CCSC2C=C1.CC |
| InChI | InChI=1S/C8H10S.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2/h1-4,7-8H,5-6H2;1-2H3 |
| InChIKey | MPPYLLPDWRBYHP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |