C15H14N2 — CID 91529404
5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,10,13(17),14-hexaene (PubChem CID 91529404) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,10,13(17),14-hexaene.
| Compound Name | 5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,10,13(17),14-hexaene |
|---|---|
| PubChem CID | 91529404 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,10,13(17),14-hexaene |
| SMILES | C1=CN2CC3=CN=CCC3=C3CC=CC(=C32)C1 |
| InChI | InChI=1S/C15H14N2/c1-3-11-4-2-8-17-10-12-9-16-7-6-13(12)14(5-1)15(11)17/h1-3,7-9H,4-6,10H2 |
| InChIKey | NUJOUGPJPNKPPV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |