C42H39FNO8P — CID 91530031
prop-2-enyl (2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-(fluoromethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 91530031) has the molecular formula C42H39FNO8P and a molecular weight of 735.75 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-(fluoromethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-(fluoromethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91530031 |
| Molecular Formula | C42H39FNO8P |
| Molecular Weight | 735.75 g/mol |
| Exact Mass | 735.24 |
| IUPAC Name | prop-2-enyl (2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-(fluoromethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)c(CF)c1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C42H39FNO8P/c1-2-23-48-41(45)39(44-42(46)49-29-38-36-19-11-9-17-34(36)35-18-10-12-20-37(35)38)25-32-21-22-40(33(24-32)26-43)52-53(47,50-27-30-13-5-3-6-14-30)51-28-31-15-7-4-8-16-31/h2-22,24,38-39H,1,23,25-29H2,(H,44,46)/t39-/m0/s1 |
| InChIKey | UDPPDGZGPPJOBS-KDXMTYKHSA-N |
| XLogP | 9.26 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.75 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|