C41H37N4O6P — CID 86720300
prop-2-enyl (2S)-3-(3-azido-4-dibenzylphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 86720300) has the molecular formula C41H37N4O6P and a molecular weight of 712.74 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-(3-azido-4-dibenzylphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-(3-azido-4-dibenzylphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 86720300 |
| Molecular Formula | C41H37N4O6P |
| Molecular Weight | 712.74 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | prop-2-enyl (2S)-3-(3-azido-4-dibenzylphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(OP(=O)(Cc2ccccc2)Cc2ccccc2)c(N=[N+]=[N-])c1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H37N4O6P/c1-2-23-49-40(46)38(43-41(47)50-26-36-34-19-11-9-17-32(34)33-18-10-12-20-35(33)36)25-31-21-22-39(37(24-31)44-45-42)51-52(48,27-29-13-5-3-6-14-29)28-30-15-7-4-8-16-30/h2-22,24,36,38H,1,23,25-28H2,(H,43,47)/t38-/m0/s1 |
| InChIKey | IDMYORGHPKEJIR-LHEWISCISA-N |
| XLogP | 9.86 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.74 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|