C21H15Cl2N3O3S — CID 91530668
[6-[1-(2,6-dichloro-4-pyridinyl)ethoxy]-1,3-benzothiazol-2-yl]-phenylcarbamic acid (PubChem CID 91530668) has the molecular formula C21H15Cl2N3O3S and a molecular weight of 460.34 g/mol. Its IUPAC name is [6-[1-(2,6-dichloro-4-pyridinyl)ethoxy]-1,3-benzothiazol-2-yl]-phenylcarbamic acid.
| Compound Name | [6-[1-(2,6-dichloro-4-pyridinyl)ethoxy]-1,3-benzothiazol-2-yl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 91530668 |
| Molecular Formula | C21H15Cl2N3O3S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | [6-[1-(2,6-dichloro-4-pyridinyl)ethoxy]-1,3-benzothiazol-2-yl]-phenylcarbamic acid |
| SMILES | CC(Oc1ccc2nc(N(C(=O)O)c3ccccc3)sc2c1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3O3S/c1-12(13-9-18(22)25-19(23)10-13)29-15-7-8-16-17(11-15)30-20(24-16)26(21(27)28)14-5-3-2-4-6-14/h2-12H,1H3,(H,27,28) |
| InChIKey | WCICIVQZLYOQIF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|