C50H50N2O8S2 — CID 91535319
1-hydroxy-4-methyl-N-[4-(3-methylphenoxy)butyl]naphthalene-2-sulfonamide;1-hydroxy-2-[(4-methylphenoxy)sulfinylamino]naphthalene;2-methylnaphthalen-1-ol (PubChem CID 91535319) has the molecular formula C50H50N2O8S2 and a molecular weight of 871.09 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-N-[4-(3-methylphenoxy)butyl]naphthalene-2-sulfonamide;1-hydroxy-2-[(4-methylphenoxy)sulfinylamino]naphthalene;2-methylnaphthalen-1-ol.
| Compound Name | 1-hydroxy-4-methyl-N-[4-(3-methylphenoxy)butyl]naphthalene-2-sulfonamide;1-hydroxy-2-[(4-methylphenoxy)sulfinylamino]naphthalene;2-methylnaphthalen-1-ol |
|---|---|
| PubChem CID | 91535319 |
| Molecular Formula | C50H50N2O8S2 |
| Molecular Weight | 871.09 g/mol |
| Exact Mass | 870.30 |
| IUPAC Name | 1-hydroxy-4-methyl-N-[4-(3-methylphenoxy)butyl]naphthalene-2-sulfonamide;1-hydroxy-2-[(4-methylphenoxy)sulfinylamino]naphthalene;2-methylnaphthalen-1-ol |
| SMILES | Cc1ccc(OS(=O)Nc2ccc3ccccc3c2O)cc1.Cc1ccc2ccccc2c1O.Cc1cccc(OCCCCNS(=O)(=O)c2cc(C)c3ccccc3c2O)c1 |
| InChI | InChI=1S/C22H25NO4S.C17H15NO3S.C11H10O/c1-16-8-7-9-18(14-16)27-13-6-5-12-23-28(25,26)21-15-17(2)19-10-3-4-11-20(19)22(21)24;1-12-6-9-14(10-7-12)21-22(20)18-16-11-8-13-4-2-3-5-15(13)17(16)19;1-8-6-7-9-4-2-3-5-10(9)11(8)12/h3-4,7-11,14-15,23-24H,5-6,12-13H2,1-2H3;2-11,18-19H,1H3;2-7,12H,1H3 |
| InChIKey | LTUTWNHRDALDIK-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.09 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|