C24H24N4O4 — CID 91536178
5-[[4-(dimethylamino)-2-methylphenyl]methylidene]-2-[4-(hydroperoxymethyl)phenyl]-4-methylidene-1,7-dihydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 91536178) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)-2-methylphenyl]methylidene]-2-[4-(hydroperoxymethyl)phenyl]-4-methylidene-1,7-dihydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 5-[[4-(dimethylamino)-2-methylphenyl]methylidene]-2-[4-(hydroperoxymethyl)phenyl]-4-methylidene-1,7-dihydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 91536178 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-[[4-(dimethylamino)-2-methylphenyl]methylidene]-2-[4-(hydroperoxymethyl)phenyl]-4-methylidene-1,7-dihydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | C=c1c(=Cc2ccc(N(C)C)cc2C)c(=O)[nH]c2[nH]n(-c3ccc(COO)cc3)c(=O)c12 |
| InChI | InChI=1S/C24H24N4O4/c1-14-11-19(27(3)4)10-7-17(14)12-20-15(2)21-22(25-23(20)29)26-28(24(21)30)18-8-5-16(6-9-18)13-32-31/h5-12,26,31H,2,13H2,1,3-4H3,(H,25,29) |
| InChIKey | MLZHNFRUUZBELW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|