C22H19N3O2 — CID 91536421
[8-(3-cyanophenyl)-1,7-naphthyridin-6-yl] cyclohexanecarboxylate (PubChem CID 91536421) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is [8-(3-cyanophenyl)-1,7-naphthyridin-6-yl] cyclohexanecarboxylate.
| Compound Name | [8-(3-cyanophenyl)-1,7-naphthyridin-6-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91536421 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [8-(3-cyanophenyl)-1,7-naphthyridin-6-yl] cyclohexanecarboxylate |
| SMILES | N#Cc1cccc(-c2nc(OC(=O)C3CCCCC3)cc3cccnc23)c1 |
| InChI | InChI=1S/C22H19N3O2/c23-14-15-6-4-9-17(12-15)21-20-18(10-5-11-24-20)13-19(25-21)27-22(26)16-7-2-1-3-8-16/h4-6,9-13,16H,1-3,7-8H2 |
| InChIKey | VYWLPQZIWVLLMK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |