C21H19N5O2 — CID 10317223
2-[4-[8-(3-cyanophenyl)-1,7-naphthyridin-6-yl]piperazin-1-yl]acetic acid (PubChem CID 10317223) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[4-[8-(3-cyanophenyl)-1,7-naphthyridin-6-yl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[8-(3-cyanophenyl)-1,7-naphthyridin-6-yl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10317223 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[4-[8-(3-cyanophenyl)-1,7-naphthyridin-6-yl]piperazin-1-yl]acetic acid |
| SMILES | N#Cc1cccc(-c2nc(N3CCN(CC(=O)O)CC3)cc3cccnc23)c1 |
| InChI | InChI=1S/C21H19N5O2/c22-13-15-3-1-4-16(11-15)21-20-17(5-2-6-23-20)12-18(24-21)26-9-7-25(8-10-26)14-19(27)28/h1-6,11-12H,7-10,14H2,(H,27,28) |
| InChIKey | SAPZVOANOIPKSM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |