C23H22N4O2 — CID 67403874
2-[4-[[6-(3-cyanophenyl)isoquinolin-8-yl]amino]piperidin-1-yl]acetic acid (PubChem CID 67403874) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[4-[[6-(3-cyanophenyl)isoquinolin-8-yl]amino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[6-(3-cyanophenyl)isoquinolin-8-yl]amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 67403874 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[4-[[6-(3-cyanophenyl)isoquinolin-8-yl]amino]piperidin-1-yl]acetic acid |
| SMILES | N#Cc1cccc(-c2cc(NC3CCN(CC(=O)O)CC3)c3cnccc3c2)c1 |
| InChI | InChI=1S/C23H22N4O2/c24-13-16-2-1-3-17(10-16)19-11-18-4-7-25-14-21(18)22(12-19)26-20-5-8-27(9-6-20)15-23(28)29/h1-4,7,10-12,14,20,26H,5-6,8-9,15H2,(H,28,29) |
| InChIKey | UJFATSXAKMXUCR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |