C29H23N5O — CID 59534932
3-[8-[[1-(3-cyanobenzoyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile (PubChem CID 59534932) has the molecular formula C29H23N5O and a molecular weight of 457.54 g/mol. Its IUPAC name is 3-[8-[[1-(3-cyanobenzoyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[8-[[1-(3-cyanobenzoyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 59534932 |
| Molecular Formula | C29H23N5O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-[8-[[1-(3-cyanobenzoyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCC(Nc3cc(-c4cccc(C#N)c4)cc4ccncc34)CC2)c1 |
| InChI | InChI=1S/C29H23N5O/c30-17-20-3-1-5-22(13-20)25-15-23-7-10-32-19-27(23)28(16-25)33-26-8-11-34(12-9-26)29(35)24-6-2-4-21(14-24)18-31/h1-7,10,13-16,19,26,33H,8-9,11-12H2 |
| InChIKey | HZYICBPNPYZORL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |