C27H21Cl2N5O — CID 59535325
3-[8-[[1-(2,6-dichloropyridine-4-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile (PubChem CID 59535325) has the molecular formula C27H21Cl2N5O and a molecular weight of 502.41 g/mol. Its IUPAC name is 3-[8-[[1-(2,6-dichloropyridine-4-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[8-[[1-(2,6-dichloropyridine-4-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 59535325 |
| Molecular Formula | C27H21Cl2N5O |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3-[8-[[1-(2,6-dichloropyridine-4-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(NC3CCN(C(=O)c4cc(Cl)nc(Cl)c4)CC3)c3cnccc3c2)c1 |
| InChI | InChI=1S/C27H21Cl2N5O/c28-25-13-21(14-26(29)33-25)27(35)34-8-5-22(6-9-34)32-24-12-20(11-19-4-7-31-16-23(19)24)18-3-1-2-17(10-18)15-30/h1-4,7,10-14,16,22,32H,5-6,8-9H2 |
| InChIKey | JNDAECHJIATKCR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|