C28H24FN5O — CID 59534940
3-[8-[[1-[2-(6-fluoro-2-pyridinyl)acetyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile (PubChem CID 59534940) has the molecular formula C28H24FN5O and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[8-[[1-[2-(6-fluoro-2-pyridinyl)acetyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[8-[[1-[2-(6-fluoro-2-pyridinyl)acetyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 59534940 |
| Molecular Formula | C28H24FN5O |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[8-[[1-[2-(6-fluoro-2-pyridinyl)acetyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(NC3CCN(C(=O)Cc4cccc(F)n4)CC3)c3cnccc3c2)c1 |
| InChI | InChI=1S/C28H24FN5O/c29-27-6-2-5-24(33-27)16-28(35)34-11-8-23(9-12-34)32-26-15-22(14-21-7-10-31-18-25(21)26)20-4-1-3-19(13-20)17-30/h1-7,10,13-15,18,23,32H,8-9,11-12,16H2 |
| InChIKey | XLHYJTIGWGVCGQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|