C26H22N4OS — CID 59534806
3-[8-[[1-(thiophene-2-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile (PubChem CID 59534806) has the molecular formula C26H22N4OS and a molecular weight of 438.56 g/mol. Its IUPAC name is 3-[8-[[1-(thiophene-2-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[8-[[1-(thiophene-2-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 59534806 |
| Molecular Formula | C26H22N4OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[8-[[1-(thiophene-2-carbonyl)piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(NC3CCN(C(=O)c4cccs4)CC3)c3cnccc3c2)c1 |
| InChI | InChI=1S/C26H22N4OS/c27-16-18-3-1-4-19(13-18)21-14-20-6-9-28-17-23(20)24(15-21)29-22-7-10-30(11-8-22)26(31)25-5-2-12-32-25/h1-6,9,12-15,17,22,29H,7-8,10-11H2 |
| InChIKey | RZHUUIXKKIGQDR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |