C17H30NO+ — CID 91542909
cyclopentyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone (PubChem CID 91542909) has the molecular formula C17H30NO+ and a molecular weight of 264.43 g/mol. Its IUPAC name is cyclopentyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone.
| Compound Name | cyclopentyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 91542909 |
| Molecular Formula | C17H30NO+ |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | cyclopentyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone |
| SMILES | CC(C)C1C(C(=O)C2CCCC2)C=CCC[N+]1(C)C |
| InChI | InChI=1S/C17H30NO/c1-13(2)16-15(11-7-8-12-18(16,3)4)17(19)14-9-5-6-10-14/h7,11,13-16H,5-6,8-10,12H2,1-4H3/q+1 |
| InChIKey | QXRCRQMXKGEFTH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|