C14H15N2O2S- — CID 9154495
4-methyl-2-(2-propan-2-ylanilino)-1,3-thiazole-5-carboxylate (PubChem CID 9154495) has the molecular formula C14H15N2O2S- and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-methyl-2-(2-propan-2-ylanilino)-1,3-thiazole-5-carboxylate.
| Compound Name | 4-methyl-2-(2-propan-2-ylanilino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9154495 |
| Molecular Formula | C14H15N2O2S- |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-methyl-2-(2-propan-2-ylanilino)-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(Nc2ccccc2C(C)C)sc1C(=O)[O-] |
| InChI | InChI=1S/C14H16N2O2S/c1-8(2)10-6-4-5-7-11(10)16-14-15-9(3)12(19-14)13(17)18/h4-8H,1-3H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | ZTZYIBHPHHETQR-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |