C26H30N4O5S — CID 21142721
2-[[5-[4-[2,6-di(propan-2-yl)anilino]-3,4-dioxobutanoyl]-4-methyl-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 21142721) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is 2-[[5-[4-[2,6-di(propan-2-yl)anilino]-3,4-dioxobutanoyl]-4-methyl-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[5-[4-[2,6-di(propan-2-yl)anilino]-3,4-dioxobutanoyl]-4-methyl-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21142721 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-[[5-[4-[2,6-di(propan-2-yl)anilino]-3,4-dioxobutanoyl]-4-methyl-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1nc(Nc2ccccc2[NH+]([O-])O)sc1C(=O)CC(=O)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C26H30N4O5S/c1-14(2)17-9-8-10-18(15(3)4)23(17)29-25(33)22(32)13-21(31)24-16(5)27-26(36-24)28-19-11-6-7-12-20(19)30(34)35/h6-12,14-15,30,34H,13H2,1-5H3,(H,27,28)(H,29,33) |
| InChIKey | HUUYZBVJEKJIKE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|