C17H18N2O2 — CID 91545974
[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-phenyldiazene (PubChem CID 91545974) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-phenyldiazene.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-phenyldiazene |
|---|---|
| PubChem CID | 91545974 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-phenyldiazene |
| SMILES | CC(C)(C/N=N/c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O2/c1-17(2,11-18-19-14-6-4-3-5-7-14)13-8-9-15-16(10-13)21-12-20-15/h3-10H,11-12H2,1-2H3/b19-18+ |
| InChIKey | VYPDZUQFZLHBEA-VHEBQXMUSA-N |
| XLogP | 4.48 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|