C10H17NO2 — CID 91550852
4-(2-buta-1,3-dien-2-yloxyethyl)morpholine (PubChem CID 91550852) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-(2-buta-1,3-dien-2-yloxyethyl)morpholine.
| Compound Name | 4-(2-buta-1,3-dien-2-yloxyethyl)morpholine |
|---|---|
| PubChem CID | 91550852 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 4-(2-buta-1,3-dien-2-yloxyethyl)morpholine |
| SMILES | C=CC(=C)OCCN1CCOCC1 |
| InChI | InChI=1S/C10H17NO2/c1-3-10(2)13-9-6-11-4-7-12-8-5-11/h3H,1-2,4-9H2 |
| InChIKey | BCJZRUKNCAJCBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|