C11H19NO2 — CID 88860280
4-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]morpholine (PubChem CID 88860280) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]morpholine.
| Compound Name | 4-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]morpholine |
|---|---|
| PubChem CID | 88860280 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]morpholine |
| SMILES | C/C=C(/C=C/N1CCOCC1)OCC |
| InChI | InChI=1S/C11H19NO2/c1-3-11(14-4-2)5-6-12-7-9-13-10-8-12/h3,5-6H,4,7-10H2,1-2H3/b6-5+,11-3- |
| InChIKey | ALPLJXFCZXNNCL-YRDVCAMUSA-N |
| XLogP | 1.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|