C12H21NO2 — CID 138716471
4-[3-[(3Z)-penta-1,3-dien-2-yl]oxypropyl]morpholine (PubChem CID 138716471) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-[3-[(3Z)-penta-1,3-dien-2-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[(3Z)-penta-1,3-dien-2-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 138716471 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-[3-[(3Z)-penta-1,3-dien-2-yl]oxypropyl]morpholine |
| SMILES | C=C(/C=C\C)OCCCN1CCOCC1 |
| InChI | InChI=1S/C12H21NO2/c1-3-5-12(2)15-9-4-6-13-7-10-14-11-8-13/h3,5H,2,4,6-11H2,1H3/b5-3- |
| InChIKey | HBCIMQSSSFCRJX-HYXAFXHYSA-N |
| XLogP | 1.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|